C8H14N2 — CID 143259256
(3E)-N,N-dimethyl-5-methyliminopenta-1,3-dien-3-amine (PubChem CID 143259256) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (3E)-N,N-dimethyl-5-methyliminopenta-1,3-dien-3-amine.
| Compound Name | (3E)-N,N-dimethyl-5-methyliminopenta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 143259256 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (3E)-N,N-dimethyl-5-methyliminopenta-1,3-dien-3-amine |
| SMILES | C=C/C(=C\C=N\C)N(C)C |
| InChI | InChI=1S/C8H14N2/c1-5-8(10(3)4)6-7-9-2/h5-7H,1H2,2-4H3/b8-6+,9-7+ |
| InChIKey | QQRPYLQURMQUPM-CDJQDVQCSA-N |
| XLogP | 1.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|