C12H23N2O2S+ — CID 143278662
CID 143278662 (PubChem CID 143278662) has the molecular formula C12H23N2O2S+ and a molecular weight of 259.40 g/mol.
| Compound Name | CID 143278662 |
|---|---|
| PubChem CID | 143278662 |
| Molecular Formula | C12H23N2O2S+ |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | — |
| SMILES | C/C=C(\C=C/C(=C/[S+](C)(N)=O)OC)CCNC |
| InChI | InChI=1S/C12H23N2O2S/c1-5-11(8-9-14-2)6-7-12(16-3)10-17(4,13)15/h5-7,10,14H,8-9H2,1-4H3,(H2,13,15)/q+1/b7-6-,11-5+,12-10- |
| InChIKey | SNHUMRKMYLRZHB-RQXNCTAUSA-N |
| XLogP | 1.59 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|