C6H12N2 — CID 143280544
(1E)-1-N,2-dimethylbuta-1,3-diene-1,3-diamine (PubChem CID 143280544) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (1E)-1-N,2-dimethylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1E)-1-N,2-dimethylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 143280544 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (1E)-1-N,2-dimethylbuta-1,3-diene-1,3-diamine |
| SMILES | C=C(N)/C(C)=C/NC |
| InChI | InChI=1S/C6H12N2/c1-5(4-8-3)6(2)7/h4,8H,2,7H2,1,3H3/b5-4+ |
| InChIKey | VCZIQHPXBAHGSW-SNAWJCMRSA-N |
| XLogP | 0.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|