C30H30FN2O5PS — CID 143298912
[4-[4-[5-[3-(4-fluorophenyl)-3-hydroxypropyl]-3-phenyl-2-sulfanylimidazolidin-4-yl]-3-hydroxyphenyl]phenyl]phosphonic acid (PubChem CID 143298912) has the molecular formula C30H30FN2O5PS and a molecular weight of 580.62 g/mol. Its IUPAC name is [4-[4-[5-[3-(4-fluorophenyl)-3-hydroxypropyl]-3-phenyl-2-sulfanylimidazolidin-4-yl]-3-hydroxyphenyl]phenyl]phosphonic acid.
| Compound Name | [4-[4-[5-[3-(4-fluorophenyl)-3-hydroxypropyl]-3-phenyl-2-sulfanylimidazolidin-4-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 143298912 |
| Molecular Formula | C30H30FN2O5PS |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | [4-[4-[5-[3-(4-fluorophenyl)-3-hydroxypropyl]-3-phenyl-2-sulfanylimidazolidin-4-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(-c2ccc(C3C(CCC(O)c4ccc(F)cc4)NC(S)N3c3ccccc3)c(O)c2)cc1 |
| InChI | InChI=1S/C30H30FN2O5PS/c31-22-11-6-20(7-12-22)27(34)17-16-26-29(33(30(40)32-26)23-4-2-1-3-5-23)25-15-10-21(18-28(25)35)19-8-13-24(14-9-19)39(36,37)38/h1-15,18,26-27,29-30,32,34-35,40H,16-17H2,(H2,36,37,38) |
| InChIKey | KTFZPIINDLUQGU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|