C32H31FNO5PS — CID 163510427
[4-[4-[(2S)-3-[4-(4-fluorophenyl)-4-hydroxybutyl]-1-phenyl-5-sulfanylidenepyrrolidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid (PubChem CID 163510427) has the molecular formula C32H31FNO5PS and a molecular weight of 591.64 g/mol. Its IUPAC name is [4-[4-[(2S)-3-[4-(4-fluorophenyl)-4-hydroxybutyl]-1-phenyl-5-sulfanylidenepyrrolidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid.
| Compound Name | [4-[4-[(2S)-3-[4-(4-fluorophenyl)-4-hydroxybutyl]-1-phenyl-5-sulfanylidenepyrrolidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 163510427 |
| Molecular Formula | C32H31FNO5PS |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | [4-[4-[(2S)-3-[4-(4-fluorophenyl)-4-hydroxybutyl]-1-phenyl-5-sulfanylidenepyrrolidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(-c2ccc([C@@H]3C(CCCC(O)c4ccc(F)cc4)CC(=S)N3c3ccccc3)c(O)c2)cc1 |
| InChI | InChI=1S/C32H31FNO5PS/c33-25-14-9-22(10-15-25)29(35)8-4-5-24-20-31(41)34(26-6-2-1-3-7-26)32(24)28-18-13-23(19-30(28)36)21-11-16-27(17-12-21)40(37,38)39/h1-3,6-7,9-19,24,29,32,35-36H,4-5,8,20H2,(H2,37,38,39)/t24?,29?,32-/m0/s1 |
| InChIKey | DCFVMPAFFNZJES-SWIHTBBNSA-N |
| XLogP | 6.80 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|