C38H35FNO5PS — CID 89278178
[4-[4-[(2S,3S)-3-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-1-(4-phenylphenyl)-5-sulfanylidenepyrrolidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid (PubChem CID 89278178) has the molecular formula C38H35FNO5PS and a molecular weight of 667.74 g/mol. Its IUPAC name is [4-[4-[(2S,3S)-3-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-1-(4-phenylphenyl)-5-sulfanylidenepyrrolidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid.
| Compound Name | [4-[4-[(2S,3S)-3-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-1-(4-phenylphenyl)-5-sulfanylidenepyrrolidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 89278178 |
| Molecular Formula | C38H35FNO5PS |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.20 |
| IUPAC Name | [4-[4-[(2S,3S)-3-[(4R)-4-(4-fluorophenyl)-4-hydroxybutyl]-1-(4-phenylphenyl)-5-sulfanylidenepyrrolidin-2-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(-c2ccc([C@@H]3[C@@H](CCC[C@@H](O)c4ccc(F)cc4)CC(=S)N3c3ccc(-c4ccccc4)cc3)c(O)c2)cc1 |
| InChI | InChI=1S/C38H35FNO5PS/c39-31-16-9-28(10-17-31)35(41)8-4-7-30-24-37(47)40(32-18-11-26(12-19-32)25-5-2-1-3-6-25)38(30)34-22-15-29(23-36(34)42)27-13-20-33(21-14-27)46(43,44)45/h1-3,5-6,9-23,30,35,38,41-42H,4,7-8,24H2,(H2,43,44,45)/t30-,35+,38-/m0/s1 |
| InChIKey | WIIVSXRCHNUEEV-LBWRERMESA-N |
| XLogP | 8.47 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|