C32H33FNO5PS2 — CID 143299055
[4-[4-[5-[4-(4-fluorophenyl)-4-hydroxybutyl]-2-methyl-3-phenyl-2-sulfanyl-1,3-thiazolidin-4-yl]-3-hydroxyphenyl]phenyl]phosphonic acid (PubChem CID 143299055) has the molecular formula C32H33FNO5PS2 and a molecular weight of 625.72 g/mol. Its IUPAC name is [4-[4-[5-[4-(4-fluorophenyl)-4-hydroxybutyl]-2-methyl-3-phenyl-2-sulfanyl-1,3-thiazolidin-4-yl]-3-hydroxyphenyl]phenyl]phosphonic acid.
| Compound Name | [4-[4-[5-[4-(4-fluorophenyl)-4-hydroxybutyl]-2-methyl-3-phenyl-2-sulfanyl-1,3-thiazolidin-4-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 143299055 |
| Molecular Formula | C32H33FNO5PS2 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | [4-[4-[5-[4-(4-fluorophenyl)-4-hydroxybutyl]-2-methyl-3-phenyl-2-sulfanyl-1,3-thiazolidin-4-yl]-3-hydroxyphenyl]phenyl]phosphonic acid |
| SMILES | CC1(S)SC(CCCC(O)c2ccc(F)cc2)C(c2ccc(-c3ccc(P(=O)(O)O)cc3)cc2O)N1c1ccccc1 |
| InChI | InChI=1S/C32H33FNO5PS2/c1-32(41)34(25-6-3-2-4-7-25)31(30(42-32)9-5-8-28(35)22-10-15-24(33)16-11-22)27-19-14-23(20-29(27)36)21-12-17-26(18-13-21)40(37,38)39/h2-4,6-7,10-20,28,30-31,35-36,41H,5,8-9H2,1H3,(H2,37,38,39) |
| InChIKey | ULIPBMCIDRSILB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|