C26H26FNO4S — CID 76604373
5-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-(2-hydroxy-4-methoxyphenyl)-3-phenyl-1,3-thiazolidin-2-one (PubChem CID 76604373) has the molecular formula C26H26FNO4S and a molecular weight of 467.56 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-(2-hydroxy-4-methoxyphenyl)-3-phenyl-1,3-thiazolidin-2-one.
| Compound Name | 5-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-(2-hydroxy-4-methoxyphenyl)-3-phenyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 76604373 |
| Molecular Formula | C26H26FNO4S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 5-[4-(4-fluorophenyl)-4-hydroxybutyl]-4-(2-hydroxy-4-methoxyphenyl)-3-phenyl-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(C2C(CCCC(O)c3ccc(F)cc3)SC(=O)N2c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C26H26FNO4S/c1-32-20-14-15-21(23(30)16-20)25-24(33-26(31)28(25)19-6-3-2-4-7-19)9-5-8-22(29)17-10-12-18(27)13-11-17/h2-4,6-7,10-16,22,24-25,29-30H,5,8-9H2,1H3 |
| InChIKey | UXGCRPVIABBHBN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|