C32H30FNO2S2 — CID 143651904
(4R,5R)-5-[4-(4-fluorophenyl)butyl]-4-(2-hydroxy-4-methoxyphenyl)-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione (PubChem CID 143651904) has the molecular formula C32H30FNO2S2 and a molecular weight of 543.73 g/mol. Its IUPAC name is (4R,5R)-5-[4-(4-fluorophenyl)butyl]-4-(2-hydroxy-4-methoxyphenyl)-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione.
| Compound Name | (4R,5R)-5-[4-(4-fluorophenyl)butyl]-4-(2-hydroxy-4-methoxyphenyl)-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 143651904 |
| Molecular Formula | C32H30FNO2S2 |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | (4R,5R)-5-[4-(4-fluorophenyl)butyl]-4-(2-hydroxy-4-methoxyphenyl)-3-(4-phenylphenyl)-1,3-thiazolidine-2-thione |
| SMILES | COc1ccc([C@@H]2[C@@H](CCCCc3ccc(F)cc3)SC(=S)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C32H30FNO2S2/c1-36-27-19-20-28(29(35)21-27)31-30(10-6-5-7-22-11-15-25(33)16-12-22)38-32(37)34(31)26-17-13-24(14-18-26)23-8-3-2-4-9-23/h2-4,8-9,11-21,30-31,35H,5-7,10H2,1H3/t30-,31-/m1/s1 |
| InChIKey | CZKLLHNRUYFWQZ-FIRIVFDPSA-N |
| XLogP | 8.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|