C33H33FN2O2S — CID 143651944
5-[4-(4-fluorophenyl)butyl]-4-(2-hydroxy-4-methoxyphenyl)-1-methyl-3-(4-phenylphenyl)imidazolidine-2-thione (PubChem CID 143651944) has the molecular formula C33H33FN2O2S and a molecular weight of 540.70 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)butyl]-4-(2-hydroxy-4-methoxyphenyl)-1-methyl-3-(4-phenylphenyl)imidazolidine-2-thione.
| Compound Name | 5-[4-(4-fluorophenyl)butyl]-4-(2-hydroxy-4-methoxyphenyl)-1-methyl-3-(4-phenylphenyl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 143651944 |
| Molecular Formula | C33H33FN2O2S |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 5-[4-(4-fluorophenyl)butyl]-4-(2-hydroxy-4-methoxyphenyl)-1-methyl-3-(4-phenylphenyl)imidazolidine-2-thione |
| SMILES | COc1ccc(C2C(CCCCc3ccc(F)cc3)N(C)C(=S)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C33H33FN2O2S/c1-35-30(11-7-6-8-23-12-16-26(34)17-13-23)32(29-21-20-28(38-2)22-31(29)37)36(33(35)39)27-18-14-25(15-19-27)24-9-4-3-5-10-24/h3-5,9-10,12-22,30,32,37H,6-8,11H2,1-2H3 |
| InChIKey | XJJORCCVFVNCLD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|