C32H31FN2O3S — CID 143652013
(4R,5S)-5-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(2-hydroxy-4-methoxyphenyl)-1-methyl-3-(4-phenylphenyl)imidazolidine-2-thione (PubChem CID 143652013) has the molecular formula C32H31FN2O3S and a molecular weight of 542.68 g/mol. Its IUPAC name is (4R,5S)-5-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(2-hydroxy-4-methoxyphenyl)-1-methyl-3-(4-phenylphenyl)imidazolidine-2-thione.
| Compound Name | (4R,5S)-5-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(2-hydroxy-4-methoxyphenyl)-1-methyl-3-(4-phenylphenyl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 143652013 |
| Molecular Formula | C32H31FN2O3S |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | (4R,5S)-5-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(2-hydroxy-4-methoxyphenyl)-1-methyl-3-(4-phenylphenyl)imidazolidine-2-thione |
| SMILES | COc1ccc([C@@H]2[C@H](CC[C@H](O)c3ccc(F)cc3)N(C)C(=S)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C32H31FN2O3S/c1-34-28(18-19-29(36)23-8-12-24(33)13-9-23)31(27-17-16-26(38-2)20-30(27)37)35(32(34)39)25-14-10-22(11-15-25)21-6-4-3-5-7-21/h3-17,20,28-29,31,36-37H,18-19H2,1-2H3/t28-,29-,31+/m0/s1 |
| InChIKey | FMDDDRXFHAZISX-GSBZAIBZSA-N |
| XLogP | 6.87 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|