C25H25FN2O4 — CID 143671705
(4R)-4-(2,4-dihydroxyphenyl)-5-[3-(4-fluorophenyl)-3-hydroxypropyl]-1-methyl-3-phenylimidazolidin-2-one (PubChem CID 143671705) has the molecular formula C25H25FN2O4 and a molecular weight of 436.48 g/mol. Its IUPAC name is (4R)-4-(2,4-dihydroxyphenyl)-5-[3-(4-fluorophenyl)-3-hydroxypropyl]-1-methyl-3-phenylimidazolidin-2-one.
| Compound Name | (4R)-4-(2,4-dihydroxyphenyl)-5-[3-(4-fluorophenyl)-3-hydroxypropyl]-1-methyl-3-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 143671705 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (4R)-4-(2,4-dihydroxyphenyl)-5-[3-(4-fluorophenyl)-3-hydroxypropyl]-1-methyl-3-phenylimidazolidin-2-one |
| SMILES | CN1C(=O)N(c2ccccc2)[C@H](c2ccc(O)cc2O)C1CCC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25FN2O4/c1-27-21(13-14-22(30)16-7-9-17(26)10-8-16)24(20-12-11-19(29)15-23(20)31)28(25(27)32)18-5-3-2-4-6-18/h2-12,15,21-22,24,29-31H,13-14H2,1H3/t21?,22?,24-/m1/s1 |
| InChIKey | NROFRONXFSXVGC-UBVWURDFSA-N |
| XLogP | 4.73 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|