C31H29FN2O3S — CID 143652063
(4S,5R)-4-[3-(4-fluorophenyl)-3-hydroxypropyl]-5-(2-hydroxy-4-methoxyphenyl)-1-(4-phenylphenyl)imidazolidine-2-thione (PubChem CID 143652063) has the molecular formula C31H29FN2O3S and a molecular weight of 528.65 g/mol. Its IUPAC name is (4S,5R)-4-[3-(4-fluorophenyl)-3-hydroxypropyl]-5-(2-hydroxy-4-methoxyphenyl)-1-(4-phenylphenyl)imidazolidine-2-thione.
| Compound Name | (4S,5R)-4-[3-(4-fluorophenyl)-3-hydroxypropyl]-5-(2-hydroxy-4-methoxyphenyl)-1-(4-phenylphenyl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 143652063 |
| Molecular Formula | C31H29FN2O3S |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (4S,5R)-4-[3-(4-fluorophenyl)-3-hydroxypropyl]-5-(2-hydroxy-4-methoxyphenyl)-1-(4-phenylphenyl)imidazolidine-2-thione |
| SMILES | COc1ccc([C@@H]2[C@H](CCC(O)c3ccc(F)cc3)NC(=S)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C31H29FN2O3S/c1-37-25-15-16-26(29(36)19-25)30-27(17-18-28(35)22-7-11-23(32)12-8-22)33-31(38)34(30)24-13-9-21(10-14-24)20-5-3-2-4-6-20/h2-16,19,27-28,30,35-36H,17-18H2,1H3,(H,33,38)/t27-,28?,30+/m0/s1 |
| InChIKey | OHWPCNQTYIDCOO-MQDSBKNASA-N |
| XLogP | 6.53 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|