C30H26FNO3S — CID 89278374
4-(2,4-dihydroxyphenyl)-5-[3-(4-fluorophenyl)propyl]-3-(4-phenylphenyl)-1,3-oxazolidine-2-thione (PubChem CID 89278374) has the molecular formula C30H26FNO3S and a molecular weight of 499.61 g/mol. Its IUPAC name is 4-(2,4-dihydroxyphenyl)-5-[3-(4-fluorophenyl)propyl]-3-(4-phenylphenyl)-1,3-oxazolidine-2-thione.
| Compound Name | 4-(2,4-dihydroxyphenyl)-5-[3-(4-fluorophenyl)propyl]-3-(4-phenylphenyl)-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 89278374 |
| Molecular Formula | C30H26FNO3S |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-(2,4-dihydroxyphenyl)-5-[3-(4-fluorophenyl)propyl]-3-(4-phenylphenyl)-1,3-oxazolidine-2-thione |
| SMILES | Oc1ccc(C2C(CCCc3ccc(F)cc3)OC(=S)N2c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C30H26FNO3S/c31-23-13-9-20(10-14-23)5-4-8-28-29(26-18-17-25(33)19-27(26)34)32(30(36)35-28)24-15-11-22(12-16-24)21-6-2-1-3-7-21/h1-3,6-7,9-19,28-29,33-34H,4-5,8H2 |
| InChIKey | OMIPJBSIAFDYAG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|