C26H28FNO3S2 — CID 143299096
2-[5-[4-(4-fluorophenyl)-4-hydroxybutyl]-3-phenyl-2-sulfanyl-1,3-thiazolidin-4-yl]-5-methoxyphenol (PubChem CID 143299096) has the molecular formula C26H28FNO3S2 and a molecular weight of 485.65 g/mol. Its IUPAC name is 2-[5-[4-(4-fluorophenyl)-4-hydroxybutyl]-3-phenyl-2-sulfanyl-1,3-thiazolidin-4-yl]-5-methoxyphenol.
| Compound Name | 2-[5-[4-(4-fluorophenyl)-4-hydroxybutyl]-3-phenyl-2-sulfanyl-1,3-thiazolidin-4-yl]-5-methoxyphenol |
|---|---|
| PubChem CID | 143299096 |
| Molecular Formula | C26H28FNO3S2 |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-[5-[4-(4-fluorophenyl)-4-hydroxybutyl]-3-phenyl-2-sulfanyl-1,3-thiazolidin-4-yl]-5-methoxyphenol |
| SMILES | COc1ccc(C2C(CCCC(O)c3ccc(F)cc3)SC(S)N2c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C26H28FNO3S2/c1-31-20-14-15-21(23(30)16-20)25-24(33-26(32)28(25)19-6-3-2-4-7-19)9-5-8-22(29)17-10-12-18(27)13-11-17/h2-4,6-7,10-16,22,24-26,29-30,32H,5,8-9H2,1H3 |
| InChIKey | BBOGXSWUXHSLEP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|