C17H20N6O3 — CID 143299537
methyl 2-[2-amino-6-[[4-(aminomethyl)phenyl]methoxy]-7H-purin-8-yl]propanoate (PubChem CID 143299537) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is methyl 2-[2-amino-6-[[4-(aminomethyl)phenyl]methoxy]-7H-purin-8-yl]propanoate.
| Compound Name | methyl 2-[2-amino-6-[[4-(aminomethyl)phenyl]methoxy]-7H-purin-8-yl]propanoate |
|---|---|
| PubChem CID | 143299537 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | methyl 2-[2-amino-6-[[4-(aminomethyl)phenyl]methoxy]-7H-purin-8-yl]propanoate |
| SMILES | COC(=O)C(C)c1nc2nc(N)nc(OCc3ccc(CN)cc3)c2[nH]1 |
| InChI | InChI=1S/C17H20N6O3/c1-9(16(24)25-2)13-20-12-14(21-13)22-17(19)23-15(12)26-8-11-5-3-10(7-18)4-6-11/h3-6,9H,7-8,18H2,1-2H3,(H3,19,20,21,22,23) |
| InChIKey | LHZNHNHSDZYTCJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |