C9H11Cl2N — CID 143310535
1,4-dihydroisoquinoline;dihydrochloride (PubChem CID 143310535) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is 1,4-dihydroisoquinoline;dihydrochloride.
| Compound Name | 1,4-dihydroisoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 143310535 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1,4-dihydroisoquinoline;dihydrochloride |
| SMILES | C1=NCc2ccccc2C1.Cl.Cl |
| InChI | InChI=1S/C9H9N.2ClH/c1-2-4-9-7-10-6-5-8(9)3-1;;/h1-4,6H,5,7H2;2*1H |
| InChIKey | DJQNHPRYLAUDJG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |