C10H13IN2S — CID 19820492
2-methylsulfanyl-1,5-dihydro-2,4-benzodiazepine;hydroiodide (PubChem CID 19820492) has the molecular formula C10H13IN2S and a molecular weight of 320.20 g/mol. Its IUPAC name is 2-methylsulfanyl-1,5-dihydro-2,4-benzodiazepine;hydroiodide.
| Compound Name | 2-methylsulfanyl-1,5-dihydro-2,4-benzodiazepine;hydroiodide |
|---|---|
| PubChem CID | 19820492 |
| Molecular Formula | C10H13IN2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 2-methylsulfanyl-1,5-dihydro-2,4-benzodiazepine;hydroiodide |
| SMILES | CSN1C=NCc2ccccc2C1.I |
| InChI | InChI=1S/C10H12N2S.HI/c1-13-12-7-10-5-3-2-4-9(10)6-11-8-12;/h2-5,8H,6-7H2,1H3;1H |
| InChIKey | YZGVQHULQLZXEK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|