C13H13N3S — CID 175827609
2-(5-methylsulfanylpyridazin-4-yl)-1,3-dihydroisoindole (PubChem CID 175827609) has the molecular formula C13H13N3S and a molecular weight of 243.34 g/mol. Its IUPAC name is 2-(5-methylsulfanylpyridazin-4-yl)-1,3-dihydroisoindole.
| Compound Name | 2-(5-methylsulfanylpyridazin-4-yl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 175827609 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-(5-methylsulfanylpyridazin-4-yl)-1,3-dihydroisoindole |
| SMILES | CSc1cnncc1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H13N3S/c1-17-13-7-15-14-6-12(13)16-8-10-4-2-3-5-11(10)9-16/h2-7H,8-9H2,1H3 |
| InChIKey | WPEYVBSDCNLLTA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |