C24H33NO4 — CID 143314096
1-[4-[4-(butoxyamino)phenyl]phenyl]-7,7-dihydroxy-2-methylheptan-1-one (PubChem CID 143314096) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is 1-[4-[4-(butoxyamino)phenyl]phenyl]-7,7-dihydroxy-2-methylheptan-1-one.
| Compound Name | 1-[4-[4-(butoxyamino)phenyl]phenyl]-7,7-dihydroxy-2-methylheptan-1-one |
|---|---|
| PubChem CID | 143314096 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 1-[4-[4-(butoxyamino)phenyl]phenyl]-7,7-dihydroxy-2-methylheptan-1-one |
| SMILES | CCCCONc1ccc(-c2ccc(C(=O)C(C)CCCCC(O)O)cc2)cc1 |
| InChI | InChI=1S/C24H33NO4/c1-3-4-17-29-25-22-15-13-20(14-16-22)19-9-11-21(12-10-19)24(28)18(2)7-5-6-8-23(26)27/h9-16,18,23,25-27H,3-8,17H2,1-2H3 |
| InChIKey | RFKPTUWHYQLERG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|