C11H17NO3 — CID 143326179
N-[(3E,5E)-5-(ethoxymethoxy)hepta-1,3,5-trien-4-yl]formamide (PubChem CID 143326179) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-[(3E,5E)-5-(ethoxymethoxy)hepta-1,3,5-trien-4-yl]formamide.
| Compound Name | N-[(3E,5E)-5-(ethoxymethoxy)hepta-1,3,5-trien-4-yl]formamide |
|---|---|
| PubChem CID | 143326179 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-[(3E,5E)-5-(ethoxymethoxy)hepta-1,3,5-trien-4-yl]formamide |
| SMILES | C=C/C=C(NC=O)\C(=C/C)OCOCC |
| InChI | InChI=1S/C11H17NO3/c1-4-7-10(12-8-13)11(5-2)15-9-14-6-3/h4-5,7-8H,1,6,9H2,2-3H3,(H,12,13)/b10-7+,11-5+ |
| InChIKey | MWRCGBXPRAYSAD-OLZFMVIBSA-N |
| XLogP | 1.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|