C28H29F2N2O2PS — CID 143328910
N-[4-(cyclohexylmethoxy)-3-[difluoro(phosphanyl)methyl]phenyl]-4-(6-methoxynaphthalen-2-yl)-1,3-thiazol-2-amine (PubChem CID 143328910) has the molecular formula C28H29F2N2O2PS and a molecular weight of 526.59 g/mol. Its IUPAC name is N-[4-(cyclohexylmethoxy)-3-[difluoro(phosphanyl)methyl]phenyl]-4-(6-methoxynaphthalen-2-yl)-1,3-thiazol-2-amine.
| Compound Name | N-[4-(cyclohexylmethoxy)-3-[difluoro(phosphanyl)methyl]phenyl]-4-(6-methoxynaphthalen-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 143328910 |
| Molecular Formula | C28H29F2N2O2PS |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N-[4-(cyclohexylmethoxy)-3-[difluoro(phosphanyl)methyl]phenyl]-4-(6-methoxynaphthalen-2-yl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc2cc(-c3csc(Nc4ccc(OCC5CCCCC5)c(C(F)(F)P)c4)n3)ccc2c1 |
| InChI | InChI=1S/C28H29F2N2O2PS/c1-33-23-11-9-19-13-21(8-7-20(19)14-23)25-17-36-27(32-25)31-22-10-12-26(24(15-22)28(29,30)35)34-16-18-5-3-2-4-6-18/h7-15,17-18H,2-6,16,35H2,1H3,(H,31,32) |
| InChIKey | VXRYQPPKSLZNGA-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|