C17H28ClNO3 — CID 143334096
6-(2-chloroethyl)-3-(cyclohex-2-en-1-ylmethyl)-3-methyl-1,4-oxazepane-2,5-dione;ethane (PubChem CID 143334096) has the molecular formula C17H28ClNO3 and a molecular weight of 329.87 g/mol. Its IUPAC name is 6-(2-chloroethyl)-3-(cyclohex-2-en-1-ylmethyl)-3-methyl-1,4-oxazepane-2,5-dione;ethane.
| Compound Name | 6-(2-chloroethyl)-3-(cyclohex-2-en-1-ylmethyl)-3-methyl-1,4-oxazepane-2,5-dione;ethane |
|---|---|
| PubChem CID | 143334096 |
| Molecular Formula | C17H28ClNO3 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 6-(2-chloroethyl)-3-(cyclohex-2-en-1-ylmethyl)-3-methyl-1,4-oxazepane-2,5-dione;ethane |
| SMILES | CC.CC1(CC2C=CCCC2)NC(=O)C(CCCl)COC1=O |
| InChI | InChI=1S/C15H22ClNO3.C2H6/c1-15(9-11-5-3-2-4-6-11)14(19)20-10-12(7-8-16)13(18)17-15;1-2/h3,5,11-12H,2,4,6-10H2,1H3,(H,17,18);1-2H3 |
| InChIKey | BXHNQUAVJQGPCK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|