About ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane
ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane (PubChem CID 143339647) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane.
Molecular Properties
| Compound Name | ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane |
| PubChem CID | 143339647 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane |
| SMILES | C.CC.CN/C(C=O)=C/c1cnc[nH]1 |
| InChI | InChI=1S/C7H9N3O.C2H6.CH4/c1-8-7(4-11)2-6-3-9-5-10-6;1-2;/h2-5,8H,1H3,(H,9,10);1-2H3;1H4/b7-2+;; |
| InChIKey | XSMTXGHIJSKGFJ-IFFVMENDSA-N |
| XLogP | 1.83 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane?
The IUPAC name of ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane (CID 143339647) is ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane.
What is the SMILES notation for ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane?
The canonical SMILES for ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane is C.CC.CN/C(C=O)=C/c1cnc[nH]1.
What is the InChIKey of ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane?
The InChIKey is XSMTXGHIJSKGFJ-IFFVMENDSA-N. The full InChI is InChI=1S/C7H9N3O.C2H6.CH4/c1-8-7(4-11)2-6-3-9-5-10-6;1-2;/h2-5,8H,1H3,(H,9,10);1-2H3;1H4/b7-2+;;.
What are the key properties of ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane?
ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane has a molecular weight of 197.28 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-3-(1H-imidazol-5-yl)-2-(methylamino)prop-2-enal;methane is sourced from PubChem (CID 143339647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).