C25H33N5O2 — CID 143341759
N'-(6,7-dimethoxy-4-piperidin-1-ylquinazolin-2-yl)-N-(3-methylphenyl)methanimidamide;ethane (PubChem CID 143341759) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N'-(6,7-dimethoxy-4-piperidin-1-ylquinazolin-2-yl)-N-(3-methylphenyl)methanimidamide;ethane.
| Compound Name | N'-(6,7-dimethoxy-4-piperidin-1-ylquinazolin-2-yl)-N-(3-methylphenyl)methanimidamide;ethane |
|---|---|
| PubChem CID | 143341759 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N'-(6,7-dimethoxy-4-piperidin-1-ylquinazolin-2-yl)-N-(3-methylphenyl)methanimidamide;ethane |
| SMILES | CC.COc1cc2nc(/N=C/Nc3cccc(C)c3)nc(N3CCCCC3)c2cc1OC |
| InChI | InChI=1S/C23H27N5O2.C2H6/c1-16-8-7-9-17(12-16)24-15-25-23-26-19-14-21(30-3)20(29-2)13-18(19)22(27-23)28-10-5-4-6-11-28;1-2/h7-9,12-15H,4-6,10-11H2,1-3H3,(H,24,25,26,27);1-2H3 |
| InChIKey | LLDVPUHCYBUQOS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|