C31H48N2 — CID 143342743
acetylene;(3E,5E)-3,6-dimethyl-7-methylidene-N-[5-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]iminohexa-1,4-dien-2-yl]nona-3,5-dien-2-amine;prop-1-ene (PubChem CID 143342743) has the molecular formula C31H48N2 and a molecular weight of 448.74 g/mol. Its IUPAC name is acetylene;(3E,5E)-3,6-dimethyl-7-methylidene-N-[5-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]iminohexa-1,4-dien-2-yl]nona-3,5-dien-2-amine;prop-1-ene.
| Compound Name | acetylene;(3E,5E)-3,6-dimethyl-7-methylidene-N-[5-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]iminohexa-1,4-dien-2-yl]nona-3,5-dien-2-amine;prop-1-ene |
|---|---|
| PubChem CID | 143342743 |
| Molecular Formula | C31H48N2 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.38 |
| IUPAC Name | acetylene;(3E,5E)-3,6-dimethyl-7-methylidene-N-[5-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]iminohexa-1,4-dien-2-yl]nona-3,5-dien-2-amine;prop-1-ene |
| SMILES | C#C.C=C(NC(C)/C(C)=C/C=C(\C)C(=C)CC)/C(C=C(C)C)=N\C(C)=C\C(C)=C/C.C=CC |
| InChI | InChI=1S/C26H40N2.C3H6.C2H2/c1-12-19(5)17-23(9)27-26(16-18(3)4)25(11)28-24(10)22(8)15-14-21(7)20(6)13-2;1-3-2;1-2/h12,14-17,24,28H,6,11,13H2,1-5,7-10H3;3H,1H2,2H3;1-2H/b19-12-,21-14+,22-15+,23-17+,27-26-;; |
| InChIKey | YXBPEWCSBQCFSL-JYFBGQKASA-N |
| XLogP | 9.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|