C13H23F3OS — CID 143346265
ethane;(3E)-3-(methylsulfanylmethyl)penta-1,3-diene;(Z)-4,4,4-trifluorobut-2-en-2-ol (PubChem CID 143346265) has the molecular formula C13H23F3OS and a molecular weight of 284.39 g/mol. Its IUPAC name is ethane;(3E)-3-(methylsulfanylmethyl)penta-1,3-diene;(Z)-4,4,4-trifluorobut-2-en-2-ol.
| Compound Name | ethane;(3E)-3-(methylsulfanylmethyl)penta-1,3-diene;(Z)-4,4,4-trifluorobut-2-en-2-ol |
|---|---|
| PubChem CID | 143346265 |
| Molecular Formula | C13H23F3OS |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | ethane;(3E)-3-(methylsulfanylmethyl)penta-1,3-diene;(Z)-4,4,4-trifluorobut-2-en-2-ol |
| SMILES | C/C(O)=C/C(F)(F)F.C=C/C(=C\C)CSC.CC |
| InChI | InChI=1S/C7H12S.C4H5F3O.C2H6/c1-4-7(5-2)6-8-3;1-3(8)2-4(5,6)7;1-2/h4-5H,1,6H2,2-3H3;2,8H,1H3;1-2H3/b7-5+;3-2-; |
| InChIKey | JAXQOYXPPGHROM-JXALRJSCSA-N |
| XLogP | 5.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|