C14H21NS2 — CID 143347498
ethane;N-methanethioyl-5,5,7-trimethylcyclohepta-1,3,6-triene-1-carbothioamide (PubChem CID 143347498) has the molecular formula C14H21NS2 and a molecular weight of 267.46 g/mol. Its IUPAC name is ethane;N-methanethioyl-5,5,7-trimethylcyclohepta-1,3,6-triene-1-carbothioamide.
| Compound Name | ethane;N-methanethioyl-5,5,7-trimethylcyclohepta-1,3,6-triene-1-carbothioamide |
|---|---|
| PubChem CID | 143347498 |
| Molecular Formula | C14H21NS2 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethane;N-methanethioyl-5,5,7-trimethylcyclohepta-1,3,6-triene-1-carbothioamide |
| SMILES | CC.CC1=CC(C)(C)C=CC=C1C(=S)NC=S |
| InChI | InChI=1S/C12H15NS2.C2H6/c1-9-7-12(2,3)6-4-5-10(9)11(15)13-8-14;1-2/h4-8H,1-3H3,(H,13,14,15);1-2H3 |
| InChIKey | ZGQYEOZAISEYQD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|