C15H25NS — CID 155001514
(2E,4Z)-N-(2,2-dimethylpropyl)-2,5,6-trimethylhepta-2,4,6-trienethioamide (PubChem CID 155001514) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is (2E,4Z)-N-(2,2-dimethylpropyl)-2,5,6-trimethylhepta-2,4,6-trienethioamide.
| Compound Name | (2E,4Z)-N-(2,2-dimethylpropyl)-2,5,6-trimethylhepta-2,4,6-trienethioamide |
|---|---|
| PubChem CID | 155001514 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (2E,4Z)-N-(2,2-dimethylpropyl)-2,5,6-trimethylhepta-2,4,6-trienethioamide |
| SMILES | C=C(C)/C(C)=C\C=C(/C)C(=S)NCC(C)(C)C |
| InChI | InChI=1S/C15H25NS/c1-11(2)12(3)8-9-13(4)14(17)16-10-15(5,6)7/h8-9H,1,10H2,2-7H3,(H,16,17)/b12-8-,13-9+ |
| InChIKey | VTAIJMOQWKFZBB-QRBCZBMESA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|