C33H51BO3 — CID 143366337
3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]pentan-3-yl]phenyl]pentan-3-ol (PubChem CID 143366337) has the molecular formula C33H51BO3 and a molecular weight of 506.58 g/mol. Its IUPAC name is 3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]pentan-3-yl]phenyl]pentan-3-ol.
| Compound Name | 3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]pentan-3-yl]phenyl]pentan-3-ol |
|---|---|
| PubChem CID | 143366337 |
| Molecular Formula | C33H51BO3 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.39 |
| IUPAC Name | 3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]pentan-3-yl]phenyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CCc1ccc(C(CC)(CC)c2ccc(B3OCC(C)(C)C(C)(C)O3)c(C)c2)cc1C |
| InChI | InChI=1S/C33H51BO3/c1-11-32(35,12-2)20-19-26-15-16-27(21-24(26)5)33(13-3,14-4)28-17-18-29(25(6)22-28)34-36-23-30(7,8)31(9,10)37-34/h15-18,21-22,35H,11-14,19-20,23H2,1-10H3 |
| InChIKey | XRILKBITZLVWCI-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|