C17H22FNO2 — CID 143367569
5-fluoro-2,3-dihydro-1H-indene;N-methylhydroxylamine;2-methylphenol (PubChem CID 143367569) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1H-indene;N-methylhydroxylamine;2-methylphenol.
| Compound Name | 5-fluoro-2,3-dihydro-1H-indene;N-methylhydroxylamine;2-methylphenol |
|---|---|
| PubChem CID | 143367569 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-fluoro-2,3-dihydro-1H-indene;N-methylhydroxylamine;2-methylphenol |
| SMILES | CNO.Cc1ccccc1O.Fc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H9F.C7H8O.CH5NO/c10-9-5-4-7-2-1-3-8(7)6-9;1-6-4-2-3-5-7(6)8;1-2-3/h4-6H,1-3H2;2-5,8H,1H3;2-3H,1H3 |
| InChIKey | SJTPNODREVAYFX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|