C13H15N — CID 143373669
(6Z)-3a,6a-dimethyl-6-prop-2-enylidenepentalen-1-imine (PubChem CID 143373669) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is (6Z)-3a,6a-dimethyl-6-prop-2-enylidenepentalen-1-imine.
| Compound Name | (6Z)-3a,6a-dimethyl-6-prop-2-enylidenepentalen-1-imine |
|---|---|
| PubChem CID | 143373669 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (6Z)-3a,6a-dimethyl-6-prop-2-enylidenepentalen-1-imine |
| SMILES | [H]/N=C1\C=CC2(C)C=C/C(=C/C=C)C12C |
| InChI | InChI=1S/C13H15N/c1-4-5-10-6-8-12(2)9-7-11(14)13(10,12)3/h4-9,14H,1H2,2-3H3/b10-5-,14-11+ |
| InChIKey | AGPYEXSPTQWOQS-PQXZXJPFSA-N |
| XLogP | 3.27 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|