C23H32O5 — CID 143374696
[4-(3,3-dimethyloxiran-2-yl)-2-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl] 4-methoxybenzoate (PubChem CID 143374696) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is [4-(3,3-dimethyloxiran-2-yl)-2-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl] 4-methoxybenzoate.
| Compound Name | [4-(3,3-dimethyloxiran-2-yl)-2-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 143374696 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [4-(3,3-dimethyloxiran-2-yl)-2-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)butan-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)(CCC2OC2(C)C)C2CCC3(C)OC3C2)cc1 |
| InChI | InChI=1S/C23H32O5/c1-21(2)18(26-21)11-13-22(3,16-10-12-23(4)19(14-16)27-23)28-20(24)15-6-8-17(25-5)9-7-15/h6-9,16,18-19H,10-14H2,1-5H3 |
| InChIKey | QOCBECNLGKCQBF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|