C20H26O4S — CID 21362927
2-(6-methyl-7-thiabicyclo[4.1.0]heptan-3-yl)propan-2-yl 4-(oxiran-2-ylmethoxy)benzoate (PubChem CID 21362927) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-(6-methyl-7-thiabicyclo[4.1.0]heptan-3-yl)propan-2-yl 4-(oxiran-2-ylmethoxy)benzoate.
| Compound Name | 2-(6-methyl-7-thiabicyclo[4.1.0]heptan-3-yl)propan-2-yl 4-(oxiran-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 21362927 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-(6-methyl-7-thiabicyclo[4.1.0]heptan-3-yl)propan-2-yl 4-(oxiran-2-ylmethoxy)benzoate |
| SMILES | CC(C)(OC(=O)c1ccc(OCC2CO2)cc1)C1CCC2(C)SC2C1 |
| InChI | InChI=1S/C20H26O4S/c1-19(2,14-8-9-20(3)17(10-14)25-20)24-18(21)13-4-6-15(7-5-13)22-11-16-12-23-16/h4-7,14,16-17H,8-12H2,1-3H3 |
| InChIKey | LDNWYNQQFWYAPM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|