C21H36N4 — CID 143375391
(2E)-N-[2-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethyl]-2-[(methylideneamino)methylidene]but-3-en-1-amine;methanamine (PubChem CID 143375391) has the molecular formula C21H36N4 and a molecular weight of 344.55 g/mol. Its IUPAC name is (2E)-N-[2-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethyl]-2-[(methylideneamino)methylidene]but-3-en-1-amine;methanamine.
| Compound Name | (2E)-N-[2-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethyl]-2-[(methylideneamino)methylidene]but-3-en-1-amine;methanamine |
|---|---|
| PubChem CID | 143375391 |
| Molecular Formula | C21H36N4 |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | (2E)-N-[2-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]-3,6-dihydro-2H-pyridin-1-yl]ethyl]-2-[(methylideneamino)methylidene]but-3-en-1-amine;methanamine |
| SMILES | C=C/C(=C\N=C)CNCCN1CC=C(C(/C=C\CC)=C/C)CC1.CN |
| InChI | InChI=1S/C20H31N3.CH5N/c1-5-8-9-19(7-3)20-10-13-23(14-11-20)15-12-22-17-18(6-2)16-21-4;1-2/h6-10,16,22H,2,4-5,11-15,17H2,1,3H3;2H2,1H3/b9-8-,18-16+,19-7+; |
| InChIKey | HQSLUJINUKMOGO-KBUZZWOSSA-N |
| XLogP | 3.47 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|