C11H11NO — CID 143408622
1-(4a,8a-dihydroquinolin-2-yl)ethanone (PubChem CID 143408622) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 1-(4a,8a-dihydroquinolin-2-yl)ethanone.
| Compound Name | 1-(4a,8a-dihydroquinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 143408622 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 1-(4a,8a-dihydroquinolin-2-yl)ethanone |
| SMILES | CC(=O)C1=NC2C=CC=CC2C=C1 |
| InChI | InChI=1S/C11H11NO/c1-8(13)10-7-6-9-4-2-3-5-11(9)12-10/h2-7,9,11H,1H3 |
| InChIKey | DDUXMQCKNSFVLS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |