C20H42 — CID 143412498
molecular hydrogen;trans-(1S,5S)-1,2-dimethyl-5-(5-methylhexyl)-1-(3-methylidenepentyl)cyclopentane (PubChem CID 143412498) has the molecular formula C20H42 and a molecular weight of 282.56 g/mol. Its IUPAC name is molecular hydrogen;trans-(1S,5S)-1,2-dimethyl-5-(5-methylhexyl)-1-(3-methylidenepentyl)cyclopentane.
| Compound Name | molecular hydrogen;trans-(1S,5S)-1,2-dimethyl-5-(5-methylhexyl)-1-(3-methylidenepentyl)cyclopentane |
|---|---|
| PubChem CID | 143412498 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | molecular hydrogen;trans-(1S,5S)-1,2-dimethyl-5-(5-methylhexyl)-1-(3-methylidenepentyl)cyclopentane |
| SMILES | C=C(CC)CC[C@@]1(C)C(C)CC[C@@H]1CCCCC(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C20H38.2H2/c1-7-17(4)14-15-20(6)18(5)12-13-19(20)11-9-8-10-16(2)3;;/h16,18-19H,4,7-15H2,1-3,5-6H3;2*1H/t18?,19-,20-;;/m0../s1 |
| InChIKey | LQYHGHXEUUVIBH-BJCIGMQLSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|