C31H50IN4O6P — CID 143414388
3-[[1-[6-(1,3-dioxoisoindol-2-yl)hexyl]piperidin-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;propoxy hypoiodite (PubChem CID 143414388) has the molecular formula C31H50IN4O6P and a molecular weight of 732.64 g/mol. Its IUPAC name is 3-[[1-[6-(1,3-dioxoisoindol-2-yl)hexyl]piperidin-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;propoxy hypoiodite.
| Compound Name | 3-[[1-[6-(1,3-dioxoisoindol-2-yl)hexyl]piperidin-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;propoxy hypoiodite |
|---|---|
| PubChem CID | 143414388 |
| Molecular Formula | C31H50IN4O6P |
| Molecular Weight | 732.64 g/mol |
| Exact Mass | 732.25 |
| IUPAC Name | 3-[[1-[6-(1,3-dioxoisoindol-2-yl)hexyl]piperidin-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;propoxy hypoiodite |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CCN(CCCCCCN2C(=O)c3ccccc3C2=O)CC1.CCCOOI |
| InChI | InChI=1S/C28H43N4O4P.C3H7IO2/c1-22(2)32(23(3)4)37(35-21-11-16-29)36-24-14-19-30(20-15-24)17-9-5-6-10-18-31-27(33)25-12-7-8-13-26(25)28(31)34;1-2-3-5-6-4/h7-8,12-13,22-24H,5-6,9-11,14-15,17-21H2,1-4H3;2-3H2,1H3 |
| InChIKey | FJHFIUPYWSAHIO-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 104.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|