C14H32N2O5P+ — CID 143416574
[hydroxy-[7-methyl-1-(methylamino)-1-oxooctan-4-yl]oxyphosphoryl]oxymethyl-trimethylazanium (PubChem CID 143416574) has the molecular formula C14H32N2O5P+ and a molecular weight of 339.39 g/mol. Its IUPAC name is [hydroxy-[7-methyl-1-(methylamino)-1-oxooctan-4-yl]oxyphosphoryl]oxymethyl-trimethylazanium.
| Compound Name | [hydroxy-[7-methyl-1-(methylamino)-1-oxooctan-4-yl]oxyphosphoryl]oxymethyl-trimethylazanium |
|---|---|
| PubChem CID | 143416574 |
| Molecular Formula | C14H32N2O5P+ |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | [hydroxy-[7-methyl-1-(methylamino)-1-oxooctan-4-yl]oxyphosphoryl]oxymethyl-trimethylazanium |
| SMILES | CNC(=O)CCC(CCC(C)C)OP(=O)(O)OC[N+](C)(C)C |
| InChI | InChI=1S/C14H31N2O5P/c1-12(2)7-8-13(9-10-14(17)15-3)21-22(18,19)20-11-16(4,5)6/h12-13H,7-11H2,1-6H3,(H-,15,17,18,19)/p+1 |
| InChIKey | CAIALTKBKBNVNB-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|