C27H39N3O5S2 — CID 143420915
S-[2-amino-3-hydroxy-6-[1-hydroxy-2-[2-[3-[[(2R)-2-phenylpropyl]-propan-2-yloxycarbonylamino]propylsulfanyl]ethylamino]ethyl]phenyl] methanethioate (PubChem CID 143420915) has the molecular formula C27H39N3O5S2 and a molecular weight of 549.76 g/mol. Its IUPAC name is S-[2-amino-3-hydroxy-6-[1-hydroxy-2-[2-[3-[[(2R)-2-phenylpropyl]-propan-2-yloxycarbonylamino]propylsulfanyl]ethylamino]ethyl]phenyl] methanethioate.
| Compound Name | S-[2-amino-3-hydroxy-6-[1-hydroxy-2-[2-[3-[[(2R)-2-phenylpropyl]-propan-2-yloxycarbonylamino]propylsulfanyl]ethylamino]ethyl]phenyl] methanethioate |
|---|---|
| PubChem CID | 143420915 |
| Molecular Formula | C27H39N3O5S2 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | S-[2-amino-3-hydroxy-6-[1-hydroxy-2-[2-[3-[[(2R)-2-phenylpropyl]-propan-2-yloxycarbonylamino]propylsulfanyl]ethylamino]ethyl]phenyl] methanethioate |
| SMILES | CC(C)OC(=O)N(CCCSCCNCC(O)c1ccc(O)c(N)c1SC=O)C[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H39N3O5S2/c1-19(2)35-27(34)30(17-20(3)21-8-5-4-6-9-21)13-7-14-36-15-12-29-16-24(33)22-10-11-23(32)25(28)26(22)37-18-31/h4-6,8-11,18-20,24,29,32-33H,7,12-17,28H2,1-3H3/t20-,24?/m0/s1 |
| InChIKey | DEWNVHQWLPVJRD-QHELBMECSA-N |
| XLogP | 4.65 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|