C18H24F2N2 — CID 143431231
5-(difluoromethyl)-N-[(5Z)-7-methyliminonona-2,5-dien-4-yl]cyclohepta-1,3,5-trien-1-amine (PubChem CID 143431231) has the molecular formula C18H24F2N2 and a molecular weight of 306.40 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-[(5Z)-7-methyliminonona-2,5-dien-4-yl]cyclohepta-1,3,5-trien-1-amine.
| Compound Name | 5-(difluoromethyl)-N-[(5Z)-7-methyliminonona-2,5-dien-4-yl]cyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143431231 |
| Molecular Formula | C18H24F2N2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 5-(difluoromethyl)-N-[(5Z)-7-methyliminonona-2,5-dien-4-yl]cyclohepta-1,3,5-trien-1-amine |
| SMILES | CC=CC(/C=C\C(CC)=N\C)NC1=CC=CC(C(F)F)=CC1 |
| InChI | InChI=1S/C18H24F2N2/c1-4-7-16(13-12-15(5-2)21-3)22-17-9-6-8-14(10-11-17)18(19)20/h4,6-10,12-13,16,18,22H,5,11H2,1-3H3/b7-4?,13-12-,21-15+ |
| InChIKey | NLLIAEYIJVAPFU-MLBIRNDZSA-N |
| XLogP | 4.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|