C31H43ClN4O6 — CID 143456218
2-[(Z)-3-amino-2-[amino(ethyl)amino]prop-2-enoxy]-2-methylpropanal;8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine;methoxymethane (PubChem CID 143456218) has the molecular formula C31H43ClN4O6 and a molecular weight of 603.16 g/mol. Its IUPAC name is 2-[(Z)-3-amino-2-[amino(ethyl)amino]prop-2-enoxy]-2-methylpropanal;8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine;methoxymethane.
| Compound Name | 2-[(Z)-3-amino-2-[amino(ethyl)amino]prop-2-enoxy]-2-methylpropanal;8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine;methoxymethane |
|---|---|
| PubChem CID | 143456218 |
| Molecular Formula | C31H43ClN4O6 |
| Molecular Weight | 603.16 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | 2-[(Z)-3-amino-2-[amino(ethyl)amino]prop-2-enoxy]-2-methylpropanal;8-chloro-6-(2,3-dimethoxyphenyl)-4,6-dihydropyrrolo[1,2-a][4,1]benzoxazepine;methoxymethane |
| SMILES | CCN(N)/C(=C\N)COC(C)(C)C=O.COC.COc1cccc(C2OCc3cccn3-c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C20H18ClNO3.C9H19N3O2.C2H6O/c1-23-18-7-3-6-15(20(18)24-2)19-16-11-13(21)8-9-17(16)22-10-4-5-14(22)12-25-19;1-4-12(11)8(5-10)6-14-9(2,3)7-13;1-3-2/h3-11,19H,12H2,1-2H3;5,7H,4,6,10-11H2,1-3H3;1-2H3/b;8-5-; |
| InChIKey | MCCYUNSFNSIZLC-QBBOVCHSSA-N |
| XLogP | 5.01 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.16 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|