C15H20 — CID 143457276
3-methylidene-6-pentan-3-yl-1,2-dihydroindene (PubChem CID 143457276) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3-methylidene-6-pentan-3-yl-1,2-dihydroindene.
| Compound Name | 3-methylidene-6-pentan-3-yl-1,2-dihydroindene |
|---|---|
| PubChem CID | 143457276 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 3-methylidene-6-pentan-3-yl-1,2-dihydroindene |
| SMILES | C=C1CCc2cc(C(CC)CC)ccc21 |
| InChI | InChI=1S/C15H20/c1-4-12(5-2)13-8-9-15-11(3)6-7-14(15)10-13/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | IZPUDHFYVOPVOP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |