C9H20N2 — CID 143462356
ethane;2-imino-3,4-dimethylpent-3-en-1-amine (PubChem CID 143462356) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is ethane;2-imino-3,4-dimethylpent-3-en-1-amine.
| Compound Name | ethane;2-imino-3,4-dimethylpent-3-en-1-amine |
|---|---|
| PubChem CID | 143462356 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | ethane;2-imino-3,4-dimethylpent-3-en-1-amine |
| SMILES | CC.[H]/N=C(\CN)C(C)=C(C)C |
| InChI | InChI=1S/C7H14N2.C2H6/c1-5(2)6(3)7(9)4-8;1-2/h9H,4,8H2,1-3H3;1-2H3/b9-7+; |
| InChIKey | KGOKJYQWADFPJC-BXTVWIJMSA-N |
| XLogP | 2.35 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|