C30H42N4O2S — CID 143463999
N-[3-[(1E,4E,6E)-4-(aminomethyl)-3-imino-7-methyl-6-(methylamino)nona-1,4,6,8-tetraenyl]phenyl]butanamide;4-[(Z)-prop-1-enyl]sulfanylpent-4-enal (PubChem CID 143463999) has the molecular formula C30H42N4O2S and a molecular weight of 522.76 g/mol. Its IUPAC name is N-[3-[(1E,4E,6E)-4-(aminomethyl)-3-imino-7-methyl-6-(methylamino)nona-1,4,6,8-tetraenyl]phenyl]butanamide;4-[(Z)-prop-1-enyl]sulfanylpent-4-enal.
| Compound Name | N-[3-[(1E,4E,6E)-4-(aminomethyl)-3-imino-7-methyl-6-(methylamino)nona-1,4,6,8-tetraenyl]phenyl]butanamide;4-[(Z)-prop-1-enyl]sulfanylpent-4-enal |
|---|---|
| PubChem CID | 143463999 |
| Molecular Formula | C30H42N4O2S |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | N-[3-[(1E,4E,6E)-4-(aminomethyl)-3-imino-7-methyl-6-(methylamino)nona-1,4,6,8-tetraenyl]phenyl]butanamide;4-[(Z)-prop-1-enyl]sulfanylpent-4-enal |
| SMILES | C=C(CCC=O)S/C=C\C.[H]/N=C(/C=C/c1cccc(NC(=O)CCC)c1)C(=C\C(NC)=C(\C)C=C)\CN |
| InChI | InChI=1S/C22H30N4O.C8H12OS/c1-5-8-22(27)26-19-10-7-9-17(13-19)11-12-20(24)18(15-23)14-21(25-4)16(3)6-2;1-3-7-10-8(2)5-4-6-9/h6-7,9-14,24-25H,2,5,8,15,23H2,1,3-4H3,(H,26,27);3,6-7H,2,4-5H2,1H3/b12-11+,18-14+,21-16+,24-20-;7-3- |
| InChIKey | DTHBOPRCRSHXJB-VOGALLNKSA-N |
| XLogP | 6.77 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|