C28H37N5OS — CID 143463883
2-[(E)-3-[3-[1-(dimethylamino)ethenylamino]phenyl]prop-2-enimidoyl]-4-N,5-dimethylbenzene-1,4-diamine;3-[(Z)-prop-1-enyl]sulfanylbut-3-enal (PubChem CID 143463883) has the molecular formula C28H37N5OS and a molecular weight of 491.71 g/mol. Its IUPAC name is 2-[(E)-3-[3-[1-(dimethylamino)ethenylamino]phenyl]prop-2-enimidoyl]-4-N,5-dimethylbenzene-1,4-diamine;3-[(Z)-prop-1-enyl]sulfanylbut-3-enal.
| Compound Name | 2-[(E)-3-[3-[1-(dimethylamino)ethenylamino]phenyl]prop-2-enimidoyl]-4-N,5-dimethylbenzene-1,4-diamine;3-[(Z)-prop-1-enyl]sulfanylbut-3-enal |
|---|---|
| PubChem CID | 143463883 |
| Molecular Formula | C28H37N5OS |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 2-[(E)-3-[3-[1-(dimethylamino)ethenylamino]phenyl]prop-2-enimidoyl]-4-N,5-dimethylbenzene-1,4-diamine;3-[(Z)-prop-1-enyl]sulfanylbut-3-enal |
| SMILES | C=C(CC=O)S/C=C\C.[H]/N=C(\C=C\c1cccc(NC(=C)N(C)C)c1)c1cc(NC)c(C)cc1N |
| InChI | InChI=1S/C21H27N5.C7H10OS/c1-14-11-20(23)18(13-21(14)24-3)19(22)10-9-16-7-6-8-17(12-16)25-15(2)26(4)5;1-3-6-9-7(2)4-5-8/h6-13,22,24-25H,2,23H2,1,3-5H3;3,5-6H,2,4H2,1H3/b10-9+,22-19+;6-3- |
| InChIKey | LAJDHIRXGRGFIX-ACJUWFPQSA-N |
| XLogP | 6.50 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|