C26H36N2O4 — CID 14346604
3-ethyl-4-[2-[6-[2-(2-ethyl-3,4-dihydroxyphenyl)ethylamino]hex-3-ynylamino]ethyl]benzene-1,2-diol (PubChem CID 14346604) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 3-ethyl-4-[2-[6-[2-(2-ethyl-3,4-dihydroxyphenyl)ethylamino]hex-3-ynylamino]ethyl]benzene-1,2-diol.
| Compound Name | 3-ethyl-4-[2-[6-[2-(2-ethyl-3,4-dihydroxyphenyl)ethylamino]hex-3-ynylamino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 14346604 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 3-ethyl-4-[2-[6-[2-(2-ethyl-3,4-dihydroxyphenyl)ethylamino]hex-3-ynylamino]ethyl]benzene-1,2-diol |
| SMILES | CCc1c(CCNCCC#CCCNCCc2ccc(O)c(O)c2CC)ccc(O)c1O |
| InChI | InChI=1S/C26H36N2O4/c1-3-21-19(9-11-23(29)25(21)31)13-17-27-15-7-5-6-8-16-28-18-14-20-10-12-24(30)26(32)22(20)4-2/h9-12,27-32H,3-4,7-8,13-18H2,1-2H3 |
| InChIKey | UIPSBTHQCZTUKI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|