C15H15NS — CID 143479628
2-methyl-2-(4-methylphenyl)-3H-1,3-benzothiazole (PubChem CID 143479628) has the molecular formula C15H15NS and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-methyl-2-(4-methylphenyl)-3H-1,3-benzothiazole.
| Compound Name | 2-methyl-2-(4-methylphenyl)-3H-1,3-benzothiazole |
|---|---|
| PubChem CID | 143479628 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-methyl-2-(4-methylphenyl)-3H-1,3-benzothiazole |
| SMILES | Cc1ccc(C2(C)Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C15H15NS/c1-11-7-9-12(10-8-11)15(2)16-13-5-3-4-6-14(13)17-15/h3-10,16H,1-2H3 |
| InChIKey | HGACCBJXHKWDEQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |