C10H12O2 — CID 143480215
3-methoxy-2-methylcyclohepta-1,3,5-triene-1-carbaldehyde (PubChem CID 143480215) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-methoxy-2-methylcyclohepta-1,3,5-triene-1-carbaldehyde.
| Compound Name | 3-methoxy-2-methylcyclohepta-1,3,5-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143480215 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3-methoxy-2-methylcyclohepta-1,3,5-triene-1-carbaldehyde |
| SMILES | COC1=CC=CCC(C=O)=C1C |
| InChI | InChI=1S/C10H12O2/c1-8-9(7-11)5-3-4-6-10(8)12-2/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | GKYGVVKLVBSPCC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|