C32H33NO5 — CID 143490773
5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid (PubChem CID 143490773) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid.
| Compound Name | 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid |
|---|---|
| PubChem CID | 143490773 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid |
| SMILES | Cc1ccc(OCCCCOc2ccc3c(c2)C(CCCCC(=O)O)c2ccccc2-3)c(-c2ccno2)c1 |
| InChI | InChI=1S/C32H33NO5/c1-22-12-15-30(29(20-22)31-16-17-33-38-31)37-19-7-6-18-36-23-13-14-27-25-9-3-2-8-24(25)26(28(27)21-23)10-4-5-11-32(34)35/h2-3,8-9,12-17,20-21,26H,4-7,10-11,18-19H2,1H3,(H,34,35) |
| InChIKey | IWIZNLKTTMNAPH-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|