About 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid
5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid (PubChem CID 143490773) has the molecular formula C32H33NO5
and a molecular weight of 511.62 g/mol. Its IUPAC name is 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid.
Molecular Properties
| Compound Name | 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid |
| PubChem CID | 143490773 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid |
| SMILES | Cc1ccc(OCCCCOc2ccc3c(c2)C(CCCCC(=O)O)c2ccccc2-3)c(-c2ccno2)c1 |
| InChI | InChI=1S/C32H33NO5/c1-22-12-15-30(29(20-22)31-16-17-33-38-31)37-19-7-6-18-36-23-13-14-27-25-9-3-2-8-24(25)26(28(27)21-23)10-4-5-11-32(34)35/h2-3,8-9,12-17,20-21,26H,4-7,10-11,18-19H2,1H3,(H,34,35) |
| InChIKey | IWIZNLKTTMNAPH-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid?
The IUPAC name of 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid (CID 143490773) is 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid.
What is the SMILES notation for 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid?
The canonical SMILES for 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid is Cc1ccc(OCCCCOc2ccc3c(c2)C(CCCCC(=O)O)c2ccccc2-3)c(-c2ccno2)c1.
What is the InChIKey of 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid?
The InChIKey is IWIZNLKTTMNAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H33NO5/c1-22-12-15-30(29(20-22)31-16-17-33-38-31)37-19-7-6-18-36-23-13-14-27-25-9-3-2-8-24(25)26(28(27)21-23)10-4-5-11-32(34)35/h2-3,8-9,12-17,20-21,26H,4-7,10-11,18-19H2,1H3,(H,34,35).
What are the key properties of 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid?
5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid has a molecular weight of 511.62 g/mol, XLogP of 7.65, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[4-[4-methyl-2-(1,2-oxazol-5-yl)phenoxy]butoxy]-9H-fluoren-9-yl]pentanoic acid is sourced from PubChem (CID 143490773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).